C14H19BrF3NO — CID 115962784
1-[5-bromo-3-methyl-2-(4,4,4-trifluorobutoxy)phenyl]propan-2-amine (PubChem CID 115962784) has the molecular formula C14H19BrF3NO and a molecular weight of 354.21 g/mol. Its IUPAC name is 1-[5-bromo-3-methyl-2-(4,4,4-trifluorobutoxy)phenyl]propan-2-amine.
| Compound Name | 1-[5-bromo-3-methyl-2-(4,4,4-trifluorobutoxy)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 115962784 |
| Molecular Formula | C14H19BrF3NO |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 1-[5-bromo-3-methyl-2-(4,4,4-trifluorobutoxy)phenyl]propan-2-amine |
| SMILES | Cc1cc(Br)cc(CC(C)N)c1OCCCC(F)(F)F |
| InChI | InChI=1S/C14H19BrF3NO/c1-9-6-12(15)8-11(7-10(2)19)13(9)20-5-3-4-14(16,17)18/h6,8,10H,3-5,7,19H2,1-2H3 |
| InChIKey | FLQJQESNVPWDEG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|