C15H20BrN3O2 — CID 115962971
2-[2-(2-aminobutyl)-4-bromo-6-methylphenoxy]-N-(cyanomethyl)acetamide (PubChem CID 115962971) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is 2-[2-(2-aminobutyl)-4-bromo-6-methylphenoxy]-N-(cyanomethyl)acetamide.
| Compound Name | 2-[2-(2-aminobutyl)-4-bromo-6-methylphenoxy]-N-(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 115962971 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-[2-(2-aminobutyl)-4-bromo-6-methylphenoxy]-N-(cyanomethyl)acetamide |
| SMILES | CCC(N)Cc1cc(Br)cc(C)c1OCC(=O)NCC#N |
| InChI | InChI=1S/C15H20BrN3O2/c1-3-13(18)8-11-7-12(16)6-10(2)15(11)21-9-14(20)19-5-4-17/h6-7,13H,3,5,8-9,18H2,1-2H3,(H,19,20) |
| InChIKey | YOSLRANWOXREIB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|