C14H18ClFN2O2 — CID 115963326
[2-(aminomethyl)-4-methoxypiperidin-1-yl]-(3-chloro-2-fluorophenyl)methanone (PubChem CID 115963326) has the molecular formula C14H18ClFN2O2 and a molecular weight of 300.76 g/mol. Its IUPAC name is [2-(aminomethyl)-4-methoxypiperidin-1-yl]-(3-chloro-2-fluorophenyl)methanone.
| Compound Name | [2-(aminomethyl)-4-methoxypiperidin-1-yl]-(3-chloro-2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 115963326 |
| Molecular Formula | C14H18ClFN2O2 |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | [2-(aminomethyl)-4-methoxypiperidin-1-yl]-(3-chloro-2-fluorophenyl)methanone |
| SMILES | COC1CCN(C(=O)c2cccc(Cl)c2F)C(CN)C1 |
| InChI | InChI=1S/C14H18ClFN2O2/c1-20-10-5-6-18(9(7-10)8-17)14(19)11-3-2-4-12(15)13(11)16/h2-4,9-10H,5-8,17H2,1H3 |
| InChIKey | UMBYGDPHNUUYBT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |