About [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine
[4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine (PubChem CID 115963475) has the molecular formula C11H21F3N2O3S
and a molecular weight of 318.36 g/mol. Its IUPAC name is [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine.
Molecular Properties
| Compound Name | [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine |
| PubChem CID | 115963475 |
| Molecular Formula | C11H21F3N2O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine |
| SMILES | COC1CCN(S(=O)(=O)CCCC(F)(F)F)C(CN)C1 |
| InChI | InChI=1S/C11H21F3N2O3S/c1-19-10-3-5-16(9(7-10)8-15)20(17,18)6-2-4-11(12,13)14/h9-10H,2-8,15H2,1H3 |
| InChIKey | BJFPLQZQNMRYDN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine?
The IUPAC name of [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine (CID 115963475) is [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine.
What is the SMILES notation for [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine?
The canonical SMILES for [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine is COC1CCN(S(=O)(=O)CCCC(F)(F)F)C(CN)C1.
What is the InChIKey of [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine?
The InChIKey is BJFPLQZQNMRYDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N2O3S/c1-19-10-3-5-16(9(7-10)8-15)20(17,18)6-2-4-11(12,13)14/h9-10H,2-8,15H2,1H3.
What are the key properties of [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine?
[4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine has a molecular weight of 318.36 g/mol, XLogP of 1.10, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methanamine is sourced from PubChem (CID 115963475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).