C12H15N3O5S — CID 115964537
4-[5-(1-hydroxyethyl)-3-nitrothiophen-2-yl]-3,3-dimethylpiperazine-2,6-dione (PubChem CID 115964537) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is 4-[5-(1-hydroxyethyl)-3-nitrothiophen-2-yl]-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-[5-(1-hydroxyethyl)-3-nitrothiophen-2-yl]-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 115964537 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-[5-(1-hydroxyethyl)-3-nitrothiophen-2-yl]-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC(O)c1cc([N+](=O)[O-])c(N2CC(=O)NC(=O)C2(C)C)s1 |
| InChI | InChI=1S/C12H15N3O5S/c1-6(16)8-4-7(15(19)20)10(21-8)14-5-9(17)13-11(18)12(14,2)3/h4,6,16H,5H2,1-3H3,(H,13,17,18) |
| InChIKey | JVYDCFIKKFGGPU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|