C13H22N4O3S — CID 115966968
1-[1-[2-(propylamino)pyrimidin-5-yl]sulfonylpyrrolidin-3-yl]ethanol (PubChem CID 115966968) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 1-[1-[2-(propylamino)pyrimidin-5-yl]sulfonylpyrrolidin-3-yl]ethanol.
| Compound Name | 1-[1-[2-(propylamino)pyrimidin-5-yl]sulfonylpyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 115966968 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-[1-[2-(propylamino)pyrimidin-5-yl]sulfonylpyrrolidin-3-yl]ethanol |
| SMILES | CCCNc1ncc(S(=O)(=O)N2CCC(C(C)O)C2)cn1 |
| InChI | InChI=1S/C13H22N4O3S/c1-3-5-14-13-15-7-12(8-16-13)21(19,20)17-6-4-11(9-17)10(2)18/h7-8,10-11,18H,3-6,9H2,1-2H3,(H,14,15,16) |
| InChIKey | GVQCSUSYDDSGBD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |