C14H23N5O2 — CID 115967129
(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone (PubChem CID 115967129) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 115967129 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | (5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone |
| SMILES | CC(C)c1ncc(NN)c(C(=O)N2CCC(C(C)O)C2)n1 |
| InChI | InChI=1S/C14H23N5O2/c1-8(2)13-16-6-11(18-15)12(17-13)14(21)19-5-4-10(7-19)9(3)20/h6,8-10,18,20H,4-5,7,15H2,1-3H3 |
| InChIKey | TUMDDLJBVLPLAE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|