C9H11BrClNO2S2 — CID 115967789
5-bromo-4-chloro-N-methyl-N-(2-methylprop-2-enyl)thiophene-2-sulfonamide (PubChem CID 115967789) has the molecular formula C9H11BrClNO2S2 and a molecular weight of 344.68 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-methyl-N-(2-methylprop-2-enyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-methyl-N-(2-methylprop-2-enyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115967789 |
| Molecular Formula | C9H11BrClNO2S2 |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 342.91 |
| IUPAC Name | 5-bromo-4-chloro-N-methyl-N-(2-methylprop-2-enyl)thiophene-2-sulfonamide |
| SMILES | C=C(C)CN(C)S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C9H11BrClNO2S2/c1-6(2)5-12(3)16(13,14)8-4-7(11)9(10)15-8/h4H,1,5H2,2-3H3 |
| InChIKey | PHYGQYZDHIAKIA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|