C21H21ClN2O3S — CID 11596862
5-[(1R)-5-[2-chloro-4-[(dimethylamino)methyl]phenoxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 11596862) has the molecular formula C21H21ClN2O3S and a molecular weight of 416.93 g/mol. Its IUPAC name is 5-[(1R)-5-[2-chloro-4-[(dimethylamino)methyl]phenoxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(1R)-5-[2-chloro-4-[(dimethylamino)methyl]phenoxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11596862 |
| Molecular Formula | C21H21ClN2O3S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 5-[(1R)-5-[2-chloro-4-[(dimethylamino)methyl]phenoxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(C)Cc1ccc(Oc2ccc3c(c2)CC[C@H]3C2SC(=O)NC2=O)c(Cl)c1 |
| InChI | InChI=1S/C21H21ClN2O3S/c1-24(2)11-12-3-8-18(17(22)9-12)27-14-5-7-15-13(10-14)4-6-16(15)19-20(25)23-21(26)28-19/h3,5,7-10,16,19H,4,6,11H2,1-2H3,(H,23,25,26)/t16-,19?/m1/s1 |
| InChIKey | MJBDFTXYDRXPEN-VTBWFHPJSA-N |
| XLogP | 4.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|