C23H17F3N4O — CID 11596977
(E)-3-(4-methylphenyl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one (PubChem CID 11596977) has the molecular formula C23H17F3N4O and a molecular weight of 422.41 g/mol. Its IUPAC name is (E)-3-(4-methylphenyl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-methylphenyl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11596977 |
| Molecular Formula | C23H17F3N4O |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (E)-3-(4-methylphenyl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)c2nnn(-c3ccnc4c(C(F)(F)F)cccc34)c2C)cc1 |
| InChI | InChI=1S/C23H17F3N4O/c1-14-6-8-16(9-7-14)10-11-20(31)21-15(2)30(29-28-21)19-12-13-27-22-17(19)4-3-5-18(22)23(24,25)26/h3-13H,1-2H3/b11-10+ |
| InChIKey | KCFKWRMAZYVZGJ-ZHACJKMWSA-N |
| XLogP | 5.35 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|