C23H38O5Si — CID 11596990
(3R,4S)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]pentan-2-yl]-3-methyloxetan-2-one (PubChem CID 11596990) has the molecular formula C23H38O5Si and a molecular weight of 422.64 g/mol. Its IUPAC name is (3R,4S)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]pentan-2-yl]-3-methyloxetan-2-one.
| Compound Name | (3R,4S)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]pentan-2-yl]-3-methyloxetan-2-one |
|---|---|
| PubChem CID | 11596990 |
| Molecular Formula | C23H38O5Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (3R,4S)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]pentan-2-yl]-3-methyloxetan-2-one |
| SMILES | COc1ccc(COCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H]2OC(=O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C23H38O5Si/c1-16(21-17(2)22(24)27-21)20(28-29(7,8)23(3,4)5)13-14-26-15-18-9-11-19(25-6)12-10-18/h9-12,16-17,20-21H,13-15H2,1-8H3/t16-,17+,20+,21-/m0/s1 |
| InChIKey | YEMWFGTYZGROGR-NLEAXPPASA-N |
| XLogP | 5.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|