C16H18N2O — CID 115969994
1-(3,6-dihydro-2H-pyridin-1-yl)-3-(1H-indol-3-yl)propan-1-one (PubChem CID 115969994) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyridin-1-yl)-3-(1H-indol-3-yl)propan-1-one.
| Compound Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-3-(1H-indol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 115969994 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-3-(1H-indol-3-yl)propan-1-one |
| SMILES | O=C(CCc1c[nH]c2ccccc12)N1CC=CCC1 |
| InChI | InChI=1S/C16H18N2O/c19-16(18-10-4-1-5-11-18)9-8-13-12-17-15-7-3-2-6-14(13)15/h1-4,6-7,12,17H,5,8-11H2 |
| InChIKey | NFTMLAHGIGCURE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|