C28H28N2O2 — CID 11597029
1-[7-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one (PubChem CID 11597029) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 1-[7-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[7-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 11597029 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-[7-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one |
| SMILES | COc1ccc2c3c([nH]c2c1)C(c1ccc(C)cc1)N(C(=O)CCc1ccccc1)CC3 |
| InChI | InChI=1S/C28H28N2O2/c1-19-8-11-21(12-9-19)28-27-24(23-14-13-22(32-2)18-25(23)29-27)16-17-30(28)26(31)15-10-20-6-4-3-5-7-20/h3-9,11-14,18,28-29H,10,15-17H2,1-2H3 |
| InChIKey | QWGSCRKGHQQIEX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|