C11H21N3O — CID 115970494
1-(1,5-dimethylpyrazol-4-yl)-N-(2-ethoxyethyl)ethanamine (PubChem CID 115970494) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-4-yl)-N-(2-ethoxyethyl)ethanamine.
| Compound Name | 1-(1,5-dimethylpyrazol-4-yl)-N-(2-ethoxyethyl)ethanamine |
|---|---|
| PubChem CID | 115970494 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-4-yl)-N-(2-ethoxyethyl)ethanamine |
| SMILES | CCOCCNC(C)c1cnn(C)c1C |
| InChI | InChI=1S/C11H21N3O/c1-5-15-7-6-12-9(2)11-8-13-14(4)10(11)3/h8-9,12H,5-7H2,1-4H3 |
| InChIKey | SWHKFKILJUIWJA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|