C15H20F3N3 — CID 115970648
1,1,1-trifluoro-2-(2-propylbenzimidazol-1-yl)pentan-3-amine (PubChem CID 115970648) has the molecular formula C15H20F3N3 and a molecular weight of 299.34 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(2-propylbenzimidazol-1-yl)pentan-3-amine.
| Compound Name | 1,1,1-trifluoro-2-(2-propylbenzimidazol-1-yl)pentan-3-amine |
|---|---|
| PubChem CID | 115970648 |
| Molecular Formula | C15H20F3N3 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1,1,1-trifluoro-2-(2-propylbenzimidazol-1-yl)pentan-3-amine |
| SMILES | CCCc1nc2ccccc2n1C(C(N)CC)C(F)(F)F |
| InChI | InChI=1S/C15H20F3N3/c1-3-7-13-20-11-8-5-6-9-12(11)21(13)14(10(19)4-2)15(16,17)18/h5-6,8-10,14H,3-4,7,19H2,1-2H3 |
| InChIKey | LMCPNJPOEQCEKL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |