C15H19N5S — CID 115971046
N-ethyl-4-[(2-propylbenzimidazol-1-yl)methyl]thiadiazol-5-amine (PubChem CID 115971046) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is N-ethyl-4-[(2-propylbenzimidazol-1-yl)methyl]thiadiazol-5-amine.
| Compound Name | N-ethyl-4-[(2-propylbenzimidazol-1-yl)methyl]thiadiazol-5-amine |
|---|---|
| PubChem CID | 115971046 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-ethyl-4-[(2-propylbenzimidazol-1-yl)methyl]thiadiazol-5-amine |
| SMILES | CCCc1nc2ccccc2n1Cc1nnsc1NCC |
| InChI | InChI=1S/C15H19N5S/c1-3-7-14-17-11-8-5-6-9-13(11)20(14)10-12-15(16-4-2)21-19-18-12/h5-6,8-9,16H,3-4,7,10H2,1-2H3 |
| InChIKey | QPXYLJCAEURAIK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |