C13H22N2O5 — CID 115971683
methyl 4-hydroxy-1-[2-(2-methylmorpholin-4-yl)-2-oxoethyl]pyrrolidine-2-carboxylate (PubChem CID 115971683) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl 4-hydroxy-1-[2-(2-methylmorpholin-4-yl)-2-oxoethyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-[2-(2-methylmorpholin-4-yl)-2-oxoethyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115971683 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | methyl 4-hydroxy-1-[2-(2-methylmorpholin-4-yl)-2-oxoethyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1CC(=O)N1CCOC(C)C1 |
| InChI | InChI=1S/C13H22N2O5/c1-9-6-14(3-4-20-9)12(17)8-15-7-10(16)5-11(15)13(18)19-2/h9-11,16H,3-8H2,1-2H3 |
| InChIKey | GLGWEEZIZRCGIW-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |