C16H17BrNOS+ — CID 11597185
1-(4-bromophenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)propan-1-one (PubChem CID 11597185) has the molecular formula C16H17BrNOS+ and a molecular weight of 351.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)propan-1-one.
| Compound Name | 1-(4-bromophenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)propan-1-one |
|---|---|
| PubChem CID | 11597185 |
| Molecular Formula | C16H17BrNOS+ |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 1-(4-bromophenyl)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)propan-1-one |
| SMILES | CC(C(=O)c1ccc(Br)cc1)[n+]1csc2c1CCCC2 |
| InChI | InChI=1S/C16H17BrNOS/c1-11(16(19)12-6-8-13(17)9-7-12)18-10-20-15-5-3-2-4-14(15)18/h6-11H,2-5H2,1H3/q+1 |
| InChIKey | SJCVYKDSHYLZOE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|