C14H23N3O3 — CID 115973001
4-methyl-4-[(4-methyl-6-propan-2-yloxypyrimidin-2-yl)amino]pentanoic acid (PubChem CID 115973001) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-methyl-4-[(4-methyl-6-propan-2-yloxypyrimidin-2-yl)amino]pentanoic acid.
| Compound Name | 4-methyl-4-[(4-methyl-6-propan-2-yloxypyrimidin-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 115973001 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-methyl-4-[(4-methyl-6-propan-2-yloxypyrimidin-2-yl)amino]pentanoic acid |
| SMILES | Cc1cc(OC(C)C)nc(NC(C)(C)CCC(=O)O)n1 |
| InChI | InChI=1S/C14H23N3O3/c1-9(2)20-11-8-10(3)15-13(16-11)17-14(4,5)7-6-12(18)19/h8-9H,6-7H2,1-5H3,(H,18,19)(H,15,16,17) |
| InChIKey | JVSDTKOIZCCQHP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |