C14H23N3O4 — CID 115973199
5-methoxy-2-[(4-methyl-6-propoxypyrimidin-2-yl)amino]pentanoic acid (PubChem CID 115973199) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 5-methoxy-2-[(4-methyl-6-propoxypyrimidin-2-yl)amino]pentanoic acid.
| Compound Name | 5-methoxy-2-[(4-methyl-6-propoxypyrimidin-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 115973199 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 5-methoxy-2-[(4-methyl-6-propoxypyrimidin-2-yl)amino]pentanoic acid |
| SMILES | CCCOc1cc(C)nc(NC(CCCOC)C(=O)O)n1 |
| InChI | InChI=1S/C14H23N3O4/c1-4-7-21-12-9-10(2)15-14(17-12)16-11(13(18)19)6-5-8-20-3/h9,11H,4-8H2,1-3H3,(H,18,19)(H,15,16,17) |
| InChIKey | RHRQNZGJIDHTIK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|