C22H24Cl2O3S — CID 11597340
3-[3,5-dichloro-4-(2-hydroxyethoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one (PubChem CID 11597340) has the molecular formula C22H24Cl2O3S and a molecular weight of 439.40 g/mol. Its IUPAC name is 3-[3,5-dichloro-4-(2-hydroxyethoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one.
| Compound Name | 3-[3,5-dichloro-4-(2-hydroxyethoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
|---|---|
| PubChem CID | 11597340 |
| Molecular Formula | C22H24Cl2O3S |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 3-[3,5-dichloro-4-(2-hydroxyethoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
| SMILES | Cc1sc(C(=O)CCc2cc(Cl)c(OCCO)c(Cl)c2)c2c1[C@H]1[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C22H24Cl2O3S/c1-11-18-13(10-14-19(18)22(14,2)3)21(28-11)17(26)5-4-12-8-15(23)20(16(24)9-12)27-7-6-25/h8-9,14,19,25H,4-7,10H2,1-3H3/t14-,19-/m1/s1 |
| InChIKey | MSWKBOBVWWEQLZ-AUUYWEPGSA-N |
| XLogP | 5.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |