C14H21N3O4 — CID 115973733
methyl 2-[4-(4-ethoxy-6-methylpyrimidin-2-yl)morpholin-2-yl]acetate (PubChem CID 115973733) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 2-[4-(4-ethoxy-6-methylpyrimidin-2-yl)morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-(4-ethoxy-6-methylpyrimidin-2-yl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 115973733 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | methyl 2-[4-(4-ethoxy-6-methylpyrimidin-2-yl)morpholin-2-yl]acetate |
| SMILES | CCOc1cc(C)nc(N2CCOC(CC(=O)OC)C2)n1 |
| InChI | InChI=1S/C14H21N3O4/c1-4-20-12-7-10(2)15-14(16-12)17-5-6-21-11(9-17)8-13(18)19-3/h7,11H,4-6,8-9H2,1-3H3 |
| InChIKey | YLOGMVCVWQCVNC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |