C17H19BrN2O3S2 — CID 11597429
N-[(4-bromophenyl)methyl]-N-(2-oxoazepan-3-yl)thiophene-2-sulfonamide (PubChem CID 11597429) has the molecular formula C17H19BrN2O3S2 and a molecular weight of 443.39 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N-(2-oxoazepan-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-[(4-bromophenyl)methyl]-N-(2-oxoazepan-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11597429 |
| Molecular Formula | C17H19BrN2O3S2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N-(2-oxoazepan-3-yl)thiophene-2-sulfonamide |
| SMILES | O=C1NCCCCC1N(Cc1ccc(Br)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H19BrN2O3S2/c18-14-8-6-13(7-9-14)12-20(15-4-1-2-10-19-17(15)21)25(22,23)16-5-3-11-24-16/h3,5-9,11,15H,1-2,4,10,12H2,(H,19,21) |
| InChIKey | KGOOILIHLBXHHX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |