About [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate
[1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 11597457) has the molecular formula C28H33N2O3+
and a molecular weight of 445.58 g/mol. Its IUPAC name is [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate.
Molecular Properties
| Compound Name | [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate |
| PubChem CID | 11597457 |
| Molecular Formula | C28H33N2O3+ |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(CCCc2ccccn2)CCC(OC(=O)C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H33N2O3/c1-30(20-10-16-25-15-8-9-19-29-25)21-17-26(18-22-30)33-27(31)28(32,23-11-4-2-5-12-23)24-13-6-3-7-14-24/h2-9,11-15,19,26,32H,10,16-18,20-22H2,1H3/q+1 |
| InChIKey | OARGCDXTKMTSDP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate?
The IUPAC name of [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate (CID 11597457) is [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate.
What is the SMILES notation for [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate?
The canonical SMILES for [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate is C[N+]1(CCCc2ccccn2)CCC(OC(=O)C(O)(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate?
The InChIKey is OARGCDXTKMTSDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33N2O3/c1-30(20-10-16-25-15-8-9-19-29-25)21-17-26(18-22-30)33-27(31)28(32,23-11-4-2-5-12-23)24-13-6-3-7-14-24/h2-9,11-15,19,26,32H,10,16-18,20-22H2,1H3/q+1.
What are the key properties of [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate?
[1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate has a molecular weight of 445.58 g/mol, XLogP of 4.10, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-4-yl] 2-hydroxy-2,2-diphenylacetate is sourced from PubChem (CID 11597457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).