C28H35N3O2 — CID 11597476
19-cyclohexyl-8-[2-(dimethylamino)ethyl]-8,12-diazatetracyclo[10.7.0.02,7.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-15-carboxylic acid (PubChem CID 11597476) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 19-cyclohexyl-8-[2-(dimethylamino)ethyl]-8,12-diazatetracyclo[10.7.0.02,7.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-15-carboxylic acid.
| Compound Name | 19-cyclohexyl-8-[2-(dimethylamino)ethyl]-8,12-diazatetracyclo[10.7.0.02,7.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-15-carboxylic acid |
|---|---|
| PubChem CID | 11597476 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 19-cyclohexyl-8-[2-(dimethylamino)ethyl]-8,12-diazatetracyclo[10.7.0.02,7.013,18]nonadeca-1(19),2,4,6,13(18),14,16-heptaene-15-carboxylic acid |
| SMILES | CN(C)CCN1CCCn2c(c(C3CCCCC3)c3ccc(C(=O)O)cc32)-c2ccccc21 |
| InChI | InChI=1S/C28H35N3O2/c1-29(2)17-18-30-15-8-16-31-25-19-21(28(32)33)13-14-22(25)26(20-9-4-3-5-10-20)27(31)23-11-6-7-12-24(23)30/h6-7,11-14,19-20H,3-5,8-10,15-18H2,1-2H3,(H,32,33) |
| InChIKey | DINLBJIWTPGRMX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |