C11H20F3NO — CID 115976194
N-(1,1,1-trifluoro-4,4-dimethylpentan-2-yl)oxolan-3-amine (PubChem CID 115976194) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is N-(1,1,1-trifluoro-4,4-dimethylpentan-2-yl)oxolan-3-amine.
| Compound Name | N-(1,1,1-trifluoro-4,4-dimethylpentan-2-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 115976194 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-(1,1,1-trifluoro-4,4-dimethylpentan-2-yl)oxolan-3-amine |
| SMILES | CC(C)(C)CC(NC1CCOC1)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-10(2,3)6-9(11(12,13)14)15-8-4-5-16-7-8/h8-9,15H,4-7H2,1-3H3 |
| InChIKey | MTKVLOXVLFFTSU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |