C13H19N3O — CID 115976769
N-(4,6-dimethyl-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 115976769) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 115976769 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(C)nc(NC(=O)C2CCNCC2)c1 |
| InChI | InChI=1S/C13H19N3O/c1-9-7-10(2)15-12(8-9)16-13(17)11-3-5-14-6-4-11/h7-8,11,14H,3-6H2,1-2H3,(H,15,16,17) |
| InChIKey | KEOXPKFCCVRJNW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |