C17H33N3O7S2 — CID 11597697
(2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide;methanesulfonic acid (PubChem CID 11597697) has the molecular formula C17H33N3O7S2 and a molecular weight of 455.60 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide;methanesulfonic acid.
| Compound Name | (2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide;methanesulfonic acid |
|---|---|
| PubChem CID | 11597697 |
| Molecular Formula | C17H33N3O7S2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C[C@@H](Cc1ccccc1)NC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C15H25N3O.2CH4O3S/c1-12(11-13-7-3-2-4-8-13)18-15(19)14(17)9-5-6-10-16;2*1-5(2,3)4/h2-4,7-8,12,14H,5-6,9-11,16-17H2,1H3,(H,18,19);2*1H3,(H,2,3,4)/t12-,14-;;/m0../s1 |
| InChIKey | CETWSOHVEGTIBR-FORAGAHYSA-N |
| XLogP | 0.20 |
| TPSA | 189.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|