C15H25N3O — CID 11597698
View drug profile → lisdexamfetamine(2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide (PubChem CID 11597698) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide |
|---|---|
| PubChem CID | 11597698 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide |
| SMILES | C[C@@H](Cc1ccccc1)NC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C15H25N3O/c1-12(11-13-7-3-2-4-8-13)18-15(19)14(17)9-5-6-10-16/h2-4,7-8,12,14H,5-6,9-11,16-17H2,1H3,(H,18,19)/t12-,14-/m0/s1 |
| InChIKey | VOBHXZCDAVEXEY-JSGCOSHPSA-N |
| XLogP | 1.19 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|