C13H24N2O2 — CID 115976998
(4-aminooxan-4-yl)-(3,4-dimethylpiperidin-1-yl)methanone (PubChem CID 115976998) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (4-aminooxan-4-yl)-(3,4-dimethylpiperidin-1-yl)methanone.
| Compound Name | (4-aminooxan-4-yl)-(3,4-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 115976998 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | (4-aminooxan-4-yl)-(3,4-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)C2(N)CCOCC2)CC1C |
| InChI | InChI=1S/C13H24N2O2/c1-10-3-6-15(9-11(10)2)12(16)13(14)4-7-17-8-5-13/h10-11H,3-9,14H2,1-2H3 |
| InChIKey | JGCSSUOJYVIMMO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |