C12H11F2NO — CID 115977103
2,4-difluoro-N-[(3-methylfuran-2-yl)methyl]aniline (PubChem CID 115977103) has the molecular formula C12H11F2NO and a molecular weight of 223.22 g/mol. Its IUPAC name is 2,4-difluoro-N-[(3-methylfuran-2-yl)methyl]aniline.
| Compound Name | 2,4-difluoro-N-[(3-methylfuran-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 115977103 |
| Molecular Formula | C12H11F2NO |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2,4-difluoro-N-[(3-methylfuran-2-yl)methyl]aniline |
| SMILES | Cc1ccoc1CNc1ccc(F)cc1F |
| InChI | InChI=1S/C12H11F2NO/c1-8-4-5-16-12(8)7-15-11-3-2-9(13)6-10(11)14/h2-6,15H,7H2,1H3 |
| InChIKey | GKACOXCMHABIEX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |