C20H18F3N7OS — CID 11597815
6-ethoxy-4-piperazin-1-yl-11-pyrazin-2-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 11597815) has the molecular formula C20H18F3N7OS and a molecular weight of 461.47 g/mol. Its IUPAC name is 6-ethoxy-4-piperazin-1-yl-11-pyrazin-2-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-ethoxy-4-piperazin-1-yl-11-pyrazin-2-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 11597815 |
| Molecular Formula | C20H18F3N7OS |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 6-ethoxy-4-piperazin-1-yl-11-pyrazin-2-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(-c3cnccn3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C20H18F3N7OS/c1-2-31-17-16-15(28-19(29-17)30-7-5-24-6-8-30)14-11(20(21,22)23)9-12(27-18(14)32-16)13-10-25-3-4-26-13/h3-4,9-10,24H,2,5-8H2,1H3 |
| InChIKey | ZPQZJLGHYSXTBM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |