C29H22N2O4 — CID 11597832
3-[(3-oxo-2,14-diazahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1(22),4,6,8,10,12(24),13,15,17,19(23),20-undecaen-9-yl)oxy]propyl 2-methylprop-2-enoate (PubChem CID 11597832) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is 3-[(3-oxo-2,14-diazahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1(22),4,6,8,10,12(24),13,15,17,19(23),20-undecaen-9-yl)oxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[(3-oxo-2,14-diazahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1(22),4,6,8,10,12(24),13,15,17,19(23),20-undecaen-9-yl)oxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11597832 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 3-[(3-oxo-2,14-diazahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1(22),4,6,8,10,12(24),13,15,17,19(23),20-undecaen-9-yl)oxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc2c3c1cccc3c(=O)n1c3cccc4cccc(nc21)c43 |
| InChI | InChI=1S/C29H22N2O4/c1-17(2)29(33)35-16-6-15-34-24-14-13-20-26-19(24)9-5-10-21(26)28(32)31-23-12-4-8-18-7-3-11-22(25(18)23)30-27(20)31/h3-5,7-14H,1,6,15-16H2,2H3 |
| InChIKey | HBNQJWOXDDTRHS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|