C14H13NO4S — CID 115979059
(E)-3-[4-methoxy-2-(1,3-thiazol-5-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 115979059) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is (E)-3-[4-methoxy-2-(1,3-thiazol-5-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-methoxy-2-(1,3-thiazol-5-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115979059 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | (E)-3-[4-methoxy-2-(1,3-thiazol-5-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)c(OCc2cncs2)c1 |
| InChI | InChI=1S/C14H13NO4S/c1-18-11-4-2-10(3-5-14(16)17)13(6-11)19-8-12-7-15-9-20-12/h2-7,9H,8H2,1H3,(H,16,17)/b5-3+ |
| InChIKey | NHHPXGPNIMDSEQ-HWKANZROSA-N |
| XLogP | 2.83 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|