C14H11FN2O3S — CID 115980091
2-[(3-amino-5-fluorophenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 115980091) has the molecular formula C14H11FN2O3S and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-[(3-amino-5-fluorophenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[(3-amino-5-fluorophenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 115980091 |
| Molecular Formula | C14H11FN2O3S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-[(3-amino-5-fluorophenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | Nc1cc(F)cc(CN2C(=O)c3ccccc3S2(=O)=O)c1 |
| InChI | InChI=1S/C14H11FN2O3S/c15-10-5-9(6-11(16)7-10)8-17-14(18)12-3-1-2-4-13(12)21(17,19)20/h1-7H,8,16H2 |
| InChIKey | KMKSGAPOZVSYRU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|