C23H22FN5O4S — CID 11598217
N-(3-fluorophenyl)-2-[2-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-1,3-thiazol-5-yl]acetamide (PubChem CID 11598217) has the molecular formula C23H22FN5O4S and a molecular weight of 483.53 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[2-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[2-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 11598217 |
| Molecular Formula | C23H22FN5O4S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | N-(3-fluorophenyl)-2-[2-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-1,3-thiazol-5-yl]acetamide |
| SMILES | COCCOc1cc2ncnc(Nc3ncc(CC(=O)Nc4cccc(F)c4)s3)c2cc1OC |
| InChI | InChI=1S/C23H22FN5O4S/c1-31-6-7-33-20-11-18-17(10-19(20)32-2)22(27-13-26-18)29-23-25-12-16(34-23)9-21(30)28-15-5-3-4-14(24)8-15/h3-5,8,10-13H,6-7,9H2,1-2H3,(H,28,30)(H,25,26,27,29) |
| InChIKey | IBQHDBZMXPNKAU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|