C16H18ClFOS — CID 115983428
1-(5-tert-butylthiophen-2-yl)-2-(2-chloro-3-fluorophenyl)ethanol (PubChem CID 115983428) has the molecular formula C16H18ClFOS and a molecular weight of 312.84 g/mol. Its IUPAC name is 1-(5-tert-butylthiophen-2-yl)-2-(2-chloro-3-fluorophenyl)ethanol.
| Compound Name | 1-(5-tert-butylthiophen-2-yl)-2-(2-chloro-3-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 115983428 |
| Molecular Formula | C16H18ClFOS |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(5-tert-butylthiophen-2-yl)-2-(2-chloro-3-fluorophenyl)ethanol |
| SMILES | CC(C)(C)c1ccc(C(O)Cc2cccc(F)c2Cl)s1 |
| InChI | InChI=1S/C16H18ClFOS/c1-16(2,3)14-8-7-13(20-14)12(19)9-10-5-4-6-11(18)15(10)17/h4-8,12,19H,9H2,1-3H3 |
| InChIKey | GJMFQDDIZBVRAJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |