C26H32F3N3O3 — CID 11598375
[(6R,9aS)-6-[4-[(2S)-2-hydroxypropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 11598375) has the molecular formula C26H32F3N3O3 and a molecular weight of 491.55 g/mol. Its IUPAC name is [(6R,9aS)-6-[4-[(2S)-2-hydroxypropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(6R,9aS)-6-[4-[(2S)-2-hydroxypropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 11598375 |
| Molecular Formula | C26H32F3N3O3 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | [(6R,9aS)-6-[4-[(2S)-2-hydroxypropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | Cc1c(OC[C@H](C)O)ccc([C@H]2CCC[C@H]3CN(C(=O)c4ccc(C(F)(F)F)nc4)CCN32)c1C |
| InChI | InChI=1S/C26H32F3N3O3/c1-16(33)15-35-23-9-8-21(17(2)18(23)3)22-6-4-5-20-14-31(11-12-32(20)22)25(34)19-7-10-24(30-13-19)26(27,28)29/h7-10,13,16,20,22,33H,4-6,11-12,14-15H2,1-3H3/t16-,20-,22+/m0/s1 |
| InChIKey | GQFVLRUQRWKMFC-XUEUYAKLSA-N |
| XLogP | 4.53 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |