C31H36N4O2 — CID 11598476
N-benzyl-2-[3-[(2R)-2-[[(2R)-2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propyl]phenyl]acetamide (PubChem CID 11598476) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is N-benzyl-2-[3-[(2R)-2-[[(2R)-2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propyl]phenyl]acetamide.
| Compound Name | N-benzyl-2-[3-[(2R)-2-[[(2R)-2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propyl]phenyl]acetamide |
|---|---|
| PubChem CID | 11598476 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | N-benzyl-2-[3-[(2R)-2-[[(2R)-2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propyl]phenyl]acetamide |
| SMILES | Cc1ccc(C)n1-c1ccc([C@@H](O)CN[C@H](C)Cc2cccc(CC(=O)NCc3ccccc3)c2)cn1 |
| InChI | InChI=1S/C31H36N4O2/c1-22(32-21-29(36)28-14-15-30(33-20-28)35-23(2)12-13-24(35)3)16-26-10-7-11-27(17-26)18-31(37)34-19-25-8-5-4-6-9-25/h4-15,17,20,22,29,32,36H,16,18-19,21H2,1-3H3,(H,34,37)/t22-,29+/m1/s1 |
| InChIKey | FTXQZWSEYONITC-MNNSJKJDSA-N |
| XLogP | 4.60 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|