C31H27NO6 — CID 11598668
diethyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate (PubChem CID 11598668) has the molecular formula C31H27NO6 and a molecular weight of 509.56 g/mol. Its IUPAC name is diethyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate.
| Compound Name | diethyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11598668 |
| Molecular Formula | C31H27NO6 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | diethyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2(O/C1=N\c1c(C)cccc1C)C(=O)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C31H27NO6/c1-5-36-29(34)24-25(30(35)37-6-2)31(38-28(24)32-26-18(3)12-11-13-19(26)4)23-17-10-9-15-21(23)20-14-7-8-16-22(20)27(31)33/h7-17H,5-6H2,1-4H3/b32-28- |
| InChIKey | AHICAJKJNLUVOY-BLCKFSMSSA-N |
| XLogP | 5.55 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|