C14H18ClNO3S2 — CID 115986925
2-chloro-4-(4-hydroxybut-1-ynyl)-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide (PubChem CID 115986925) has the molecular formula C14H18ClNO3S2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 2-chloro-4-(4-hydroxybut-1-ynyl)-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide.
| Compound Name | 2-chloro-4-(4-hydroxybut-1-ynyl)-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115986925 |
| Molecular Formula | C14H18ClNO3S2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2-chloro-4-(4-hydroxybut-1-ynyl)-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
| SMILES | CSCCN(C)S(=O)(=O)c1ccc(C#CCCO)cc1Cl |
| InChI | InChI=1S/C14H18ClNO3S2/c1-16(8-10-20-2)21(18,19)14-7-6-12(11-13(14)15)5-3-4-9-17/h6-7,11,17H,4,8-10H2,1-2H3 |
| InChIKey | CQJZMZPMUNZWLC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|