C16H27N3OS — CID 115986998
1-methyl-1-(2-methylsulfanylethyl)-3-[3-[1-(propylamino)ethyl]phenyl]urea (PubChem CID 115986998) has the molecular formula C16H27N3OS and a molecular weight of 309.48 g/mol. Its IUPAC name is 1-methyl-1-(2-methylsulfanylethyl)-3-[3-[1-(propylamino)ethyl]phenyl]urea.
| Compound Name | 1-methyl-1-(2-methylsulfanylethyl)-3-[3-[1-(propylamino)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 115986998 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-methyl-1-(2-methylsulfanylethyl)-3-[3-[1-(propylamino)ethyl]phenyl]urea |
| SMILES | CCCNC(C)c1cccc(NC(=O)N(C)CCSC)c1 |
| InChI | InChI=1S/C16H27N3OS/c1-5-9-17-13(2)14-7-6-8-15(12-14)18-16(20)19(3)10-11-21-4/h6-8,12-13,17H,5,9-11H2,1-4H3,(H,18,20) |
| InChIKey | JVPMQJGRXUJYSD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |