C15H28N4S — CID 115987694
6-[(tert-butylamino)methyl]-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyrazin-2-amine (PubChem CID 115987694) has the molecular formula C15H28N4S and a molecular weight of 296.48 g/mol. Its IUPAC name is 6-[(tert-butylamino)methyl]-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyrazin-2-amine.
| Compound Name | 6-[(tert-butylamino)methyl]-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 115987694 |
| Molecular Formula | C15H28N4S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 6-[(tert-butylamino)methyl]-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyrazin-2-amine |
| SMILES | CCC(CSC)N(C)c1cncc(CNC(C)(C)C)n1 |
| InChI | InChI=1S/C15H28N4S/c1-7-13(11-20-6)19(5)14-10-16-8-12(18-14)9-17-15(2,3)4/h8,10,13,17H,7,9,11H2,1-6H3 |
| InChIKey | RMGWWQLRKYMZNO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |