C16H24N2OS — CID 115987741
N-[[2-(ethylaminomethyl)-1-benzofuran-3-yl]methyl]-N-methyl-2-methylsulfanylethanamine (PubChem CID 115987741) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-[[2-(ethylaminomethyl)-1-benzofuran-3-yl]methyl]-N-methyl-2-methylsulfanylethanamine.
| Compound Name | N-[[2-(ethylaminomethyl)-1-benzofuran-3-yl]methyl]-N-methyl-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 115987741 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-[[2-(ethylaminomethyl)-1-benzofuran-3-yl]methyl]-N-methyl-2-methylsulfanylethanamine |
| SMILES | CCNCc1oc2ccccc2c1CN(C)CCSC |
| InChI | InChI=1S/C16H24N2OS/c1-4-17-11-16-14(12-18(2)9-10-20-3)13-7-5-6-8-15(13)19-16/h5-8,17H,4,9-12H2,1-3H3 |
| InChIKey | YQWPLUGKFLCJNX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |