C30H48ClN3O2 — CID 11598796
(3S)-3-(cyclohexylmethyl)-9-(6-phenylhexyl)-1-propyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione;hydrochloride (PubChem CID 11598796) has the molecular formula C30H48ClN3O2 and a molecular weight of 518.19 g/mol. Its IUPAC name is (3S)-3-(cyclohexylmethyl)-9-(6-phenylhexyl)-1-propyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione;hydrochloride.
| Compound Name | (3S)-3-(cyclohexylmethyl)-9-(6-phenylhexyl)-1-propyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 11598796 |
| Molecular Formula | C30H48ClN3O2 |
| Molecular Weight | 518.19 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | (3S)-3-(cyclohexylmethyl)-9-(6-phenylhexyl)-1-propyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione;hydrochloride |
| SMILES | CCCN1C(=O)[C@H](CC2CCCCC2)NC(=O)C12CCN(CCCCCCc1ccccc1)CC2.Cl |
| InChI | InChI=1S/C30H47N3O2.ClH/c1-2-20-33-28(34)27(24-26-16-10-6-11-17-26)31-29(35)30(33)18-22-32(23-19-30)21-12-4-3-7-13-25-14-8-5-9-15-25;/h5,8-9,14-15,26-27H,2-4,6-7,10-13,16-24H2,1H3,(H,31,35);1H/t27-;/m0./s1 |
| InChIKey | WGUYPESPPJOOPZ-YCBFMBTMSA-N |
| XLogP | 5.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.19 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|