C20H22Cl2N4O — CID 11598824
(10S)-3-(2,4-dichlorophenyl)-10-ethyl-9-(2-methoxyethyl)-6-methyl-1,2,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene (PubChem CID 11598824) has the molecular formula C20H22Cl2N4O and a molecular weight of 405.33 g/mol. Its IUPAC name is (10S)-3-(2,4-dichlorophenyl)-10-ethyl-9-(2-methoxyethyl)-6-methyl-1,2,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene.
| Compound Name | (10S)-3-(2,4-dichlorophenyl)-10-ethyl-9-(2-methoxyethyl)-6-methyl-1,2,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 11598824 |
| Molecular Formula | C20H22Cl2N4O |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (10S)-3-(2,4-dichlorophenyl)-10-ethyl-9-(2-methoxyethyl)-6-methyl-1,2,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
| SMILES | CC[C@H]1Cn2nc(-c3ccc(Cl)cc3Cl)c3nc(C)cc(c32)N1CCOC |
| InChI | InChI=1S/C20H22Cl2N4O/c1-4-14-11-26-20-17(25(14)7-8-27-3)9-12(2)23-19(20)18(24-26)15-6-5-13(21)10-16(15)22/h5-6,9-10,14H,4,7-8,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | OKWDLKHJGAXFSE-AWEZNQCLSA-N |
| XLogP | 4.96 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |