C22H22Cl3N5O3S — CID 1159887
4-methyl-N-[(1R)-2,2,2-trichloro-1-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]ethyl]benzamide (PubChem CID 1159887) has the molecular formula C22H22Cl3N5O3S and a molecular weight of 542.88 g/mol. Its IUPAC name is 4-methyl-N-[(1R)-2,2,2-trichloro-1-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]ethyl]benzamide.
| Compound Name | 4-methyl-N-[(1R)-2,2,2-trichloro-1-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 1159887 |
| Molecular Formula | C22H22Cl3N5O3S |
| Molecular Weight | 542.88 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 4-methyl-N-[(1R)-2,2,2-trichloro-1-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](Nc2ccc(S(=O)(=O)Nc3nc(C)cc(C)n3)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C22H22Cl3N5O3S/c1-13-4-6-16(7-5-13)19(31)29-20(22(23,24)25)28-17-8-10-18(11-9-17)34(32,33)30-21-26-14(2)12-15(3)27-21/h4-12,20,28H,1-3H3,(H,29,31)(H,26,27,30)/t20-/m1/s1 |
| InChIKey | VZHQCMZIPMCDBF-HXUWFJFHSA-N |
| XLogP | 4.74 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.88 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|