C29H25F3NO3P — CID 11598890
[(2S,3S,5S,6R)-2-oxo-3,5,6-triphenyl-1,4,2λ5-oxazaphosphinan-2-yl]-[4-(trifluoromethyl)phenyl]methanol (PubChem CID 11598890) has the molecular formula C29H25F3NO3P and a molecular weight of 523.49 g/mol. Its IUPAC name is [(2S,3S,5S,6R)-2-oxo-3,5,6-triphenyl-1,4,2λ5-oxazaphosphinan-2-yl]-[4-(trifluoromethyl)phenyl]methanol.
| Compound Name | [(2S,3S,5S,6R)-2-oxo-3,5,6-triphenyl-1,4,2λ5-oxazaphosphinan-2-yl]-[4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 11598890 |
| Molecular Formula | C29H25F3NO3P |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | [(2S,3S,5S,6R)-2-oxo-3,5,6-triphenyl-1,4,2λ5-oxazaphosphinan-2-yl]-[4-(trifluoromethyl)phenyl]methanol |
| SMILES | O=[P@]1(C(O)c2ccc(C(F)(F)F)cc2)O[C@H](c2ccccc2)[C@H](c2ccccc2)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H25F3NO3P/c30-29(31,32)24-18-16-23(17-19-24)28(34)37(35)27(22-14-8-3-9-15-22)33-25(20-10-4-1-5-11-20)26(36-37)21-12-6-2-7-13-21/h1-19,25-28,33-34H/t25-,26+,27-,28?,37-/m0/s1 |
| InChIKey | LDRMMEBPZHMXAR-JOZASZDTSA-N |
| XLogP | 7.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|