C24H18F6N4O3 — CID 11598907
N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]-2-[(3-oxo-1,2-dihydroisoindol-5-yl)amino]pyridine-3-carboxamide (PubChem CID 11598907) has the molecular formula C24H18F6N4O3 and a molecular weight of 524.42 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]-2-[(3-oxo-1,2-dihydroisoindol-5-yl)amino]pyridine-3-carboxamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]-2-[(3-oxo-1,2-dihydroisoindol-5-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11598907 |
| Molecular Formula | C24H18F6N4O3 |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]-2-[(3-oxo-1,2-dihydroisoindol-5-yl)amino]pyridine-3-carboxamide |
| SMILES | COC(c1ccc(NC(=O)c2cccnc2Nc2ccc3c(c2)C(=O)NC3)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H18F6N4O3/c1-37-22(23(25,26)27,24(28,29)30)14-5-8-15(9-6-14)34-21(36)17-3-2-10-31-19(17)33-16-7-4-13-12-32-20(35)18(13)11-16/h2-11H,12H2,1H3,(H,31,33)(H,32,35)(H,34,36) |
| InChIKey | OYSAMEKXUXUXAO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |