C30H25N7O3 — CID 11599012
1-[4-methoxy-7-(5-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-phenyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)ethane-1,2-dione (PubChem CID 11599012) has the molecular formula C30H25N7O3 and a molecular weight of 531.58 g/mol. Its IUPAC name is 1-[4-methoxy-7-(5-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-phenyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)ethane-1,2-dione.
| Compound Name | 1-[4-methoxy-7-(5-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-phenyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 11599012 |
| Molecular Formula | C30H25N7O3 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 1-[4-methoxy-7-(5-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-phenyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)ethane-1,2-dione |
| SMILES | COc1cnc(-n2ncnc2C)c2[nH]cc(C(=O)C(=O)N3CCc4c(c5ccccc5n4-c4ccccc4)C3)c12 |
| InChI | InChI=1S/C30H25N7O3/c1-18-33-17-34-37(18)29-27-26(25(40-2)15-32-29)21(14-31-27)28(38)30(39)35-13-12-24-22(16-35)20-10-6-7-11-23(20)36(24)19-8-4-3-5-9-19/h3-11,14-15,17,31H,12-13,16H2,1-2H3 |
| InChIKey | ZAGDJRUFBOCVSV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|